C26H28Cl2N6O3 — CID 19339511
N-[1-[(2,6-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide (PubChem CID 19339511) has the molecular formula C26H28Cl2N6O3 and a molecular weight of 543.46 g/mol. Its IUPAC name is N-[1-[(2,6-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide.
| Compound Name | N-[1-[(2,6-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 19339511 |
| Molecular Formula | C26H28Cl2N6O3 |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | N-[1-[(2,6-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetamide |
| SMILES | Cc1cc(NC(=O)CC23CC4CC(C2)CC(n2cc([N+](=O)[O-])cn2)(C4)C3)nn1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H28Cl2N6O3/c1-16-5-23(31-32(16)14-20-21(27)3-2-4-22(20)28)30-24(35)11-25-7-17-6-18(8-25)10-26(9-17,15-25)33-13-19(12-29-33)34(36)37/h2-5,12-13,17-18H,6-11,14-15H2,1H3,(H,30,31,35) |
| InChIKey | LABCEZKQEJNZDI-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|