C25H31N9O4 — CID 19336628
N-(1,5-dimethylpyrazol-4-yl)-1-methyl-4-[[2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]pyrazole-5-carboxamide (PubChem CID 19336628) has the molecular formula C25H31N9O4 and a molecular weight of 521.58 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazol-4-yl)-1-methyl-4-[[2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]pyrazole-5-carboxamide.
| Compound Name | N-(1,5-dimethylpyrazol-4-yl)-1-methyl-4-[[2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19336628 |
| Molecular Formula | C25H31N9O4 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | N-(1,5-dimethylpyrazol-4-yl)-1-methyl-4-[[2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]pyrazole-5-carboxamide |
| SMILES | Cc1c(NC(=O)c2c(NC(=O)CC34CC5CC(C3)CC(n3cc([N+](=O)[O-])cn3)(C5)C4)cnn2C)cnn1C |
| InChI | InChI=1S/C25H31N9O4/c1-15-19(11-26-31(15)2)30-23(36)22-20(12-27-32(22)3)29-21(35)9-24-5-16-4-17(6-24)8-25(7-16,14-24)33-13-18(10-28-33)34(37)38/h10-13,16-17H,4-9,14H2,1-3H3,(H,29,35)(H,30,36) |
| InChIKey | RREGNVTYFLOJEZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 154.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|