C25H29N7O5 — CID 19400487
N-(furan-2-ylmethyl)-1-methyl-4-[[2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]pyrazole-3-carboxamide (PubChem CID 19400487) has the molecular formula C25H29N7O5 and a molecular weight of 507.55 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-methyl-4-[[2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]pyrazole-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-methyl-4-[[2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19400487 |
| Molecular Formula | C25H29N7O5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-methyl-4-[[2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]acetyl]amino]pyrazole-3-carboxamide |
| SMILES | Cn1cc(NC(=O)CC23CC4CC(C2)CC(n2cc([N+](=O)[O-])cn2)(C4)C3)c(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C25H29N7O5/c1-30-14-20(22(29-30)23(34)26-12-19-3-2-4-37-19)28-21(33)10-24-6-16-5-17(7-24)9-25(8-16,15-24)31-13-18(11-27-31)32(35)36/h2-4,11,13-14,16-17H,5-10,12,15H2,1H3,(H,26,34)(H,28,33) |
| InChIKey | DQAMWFNTXIYEAR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 150.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|