C26H32ClN5O3 — CID 19294891
1-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]ethanone (PubChem CID 19294891) has the molecular formula C26H32ClN5O3 and a molecular weight of 498.03 g/mol. Its IUPAC name is 1-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]ethanone.
| Compound Name | 1-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]ethanone |
|---|---|
| PubChem CID | 19294891 |
| Molecular Formula | C26H32ClN5O3 |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 1-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-2-[3-(4-nitropyrazol-1-yl)-1-adamantyl]ethanone |
| SMILES | O=C(CC12CC3CC(C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2)N1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C26H32ClN5O3/c27-23-4-2-1-3-21(23)16-29-5-7-30(8-6-29)24(33)14-25-10-19-9-20(11-25)13-26(12-19,18-25)31-17-22(15-28-31)32(34)35/h1-4,15,17,19-20H,5-14,16,18H2 |
| InChIKey | RAGPFFZGKLNOTE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|