C27H33ClFN5O3 — CID 19327403
2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]-1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]ethanone (PubChem CID 19327403) has the molecular formula C27H33ClFN5O3 and a molecular weight of 530.04 g/mol. Its IUPAC name is 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]-1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]-1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 19327403 |
| Molecular Formula | C27H33ClFN5O3 |
| Molecular Weight | 530.04 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 2-[3-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-1-adamantyl]-1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]ethanone |
| SMILES | Cc1c(Cl)c([N+](=O)[O-])nn1C12CC3CC(CC(CC(=O)N4CCN(Cc5ccccc5F)CC4)(C3)C1)C2 |
| InChI | InChI=1S/C27H33ClFN5O3/c1-18-24(28)25(34(36)37)30-33(18)27-13-19-10-20(14-27)12-26(11-19,17-27)15-23(35)32-8-6-31(7-9-32)16-21-4-2-3-5-22(21)29/h2-5,19-20H,6-17H2,1H3 |
| InChIKey | SNUIORVTOGXEMJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.04 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|