C26H31BrFN5O3 — CID 19323426
2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanone (PubChem CID 19323426) has the molecular formula C26H31BrFN5O3 and a molecular weight of 560.47 g/mol. Its IUPAC name is 2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 19323426 |
| Molecular Formula | C26H31BrFN5O3 |
| Molecular Weight | 560.47 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CC12CC3CC(C1)CC(n1cc(Br)c([N+](=O)[O-])n1)(C3)C2)N1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H31BrFN5O3/c27-22-16-32(29-24(22)33(35)36)26-12-19-9-20(13-26)11-25(10-19,17-26)14-23(34)31-7-5-30(6-8-31)15-18-1-3-21(28)4-2-18/h1-4,16,19-20H,5-15,17H2 |
| InChIKey | KINBXQCZQKXJRG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|