C20H24BrClN6O3 — CID 19283437
2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]-N-[2-(4-chloropyrazol-1-yl)ethyl]acetamide (PubChem CID 19283437) has the molecular formula C20H24BrClN6O3 and a molecular weight of 511.81 g/mol. Its IUPAC name is 2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]-N-[2-(4-chloropyrazol-1-yl)ethyl]acetamide.
| Compound Name | 2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]-N-[2-(4-chloropyrazol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 19283437 |
| Molecular Formula | C20H24BrClN6O3 |
| Molecular Weight | 511.81 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 2-[3-(4-bromo-3-nitropyrazol-1-yl)-1-adamantyl]-N-[2-(4-chloropyrazol-1-yl)ethyl]acetamide |
| SMILES | O=C(CC12CC3CC(C1)CC(n1cc(Br)c([N+](=O)[O-])n1)(C3)C2)NCCn1cc(Cl)cn1 |
| InChI | InChI=1S/C20H24BrClN6O3/c21-16-11-27(25-18(16)28(30)31)20-6-13-3-14(7-20)5-19(4-13,12-20)8-17(29)23-1-2-26-10-15(22)9-24-26/h9-11,13-14H,1-8,12H2,(H,23,29) |
| InChIKey | XEXSFJQYYNVDAM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|