C19H24FN5O3 — CID 19558473
3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]propan-1-one (PubChem CID 19558473) has the molecular formula C19H24FN5O3 and a molecular weight of 389.43 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 19558473 |
| Molecular Formula | C19H24FN5O3 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]propan-1-one |
| SMILES | Cc1nn(CCC(=O)N2CCN(Cc3ccccc3F)CC2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24FN5O3/c1-14-19(25(27)28)15(2)24(21-14)8-7-18(26)23-11-9-22(10-12-23)13-16-5-3-4-6-17(16)20/h3-6H,7-13H2,1-2H3 |
| InChIKey | TVJXXAFTKFNFKK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|