C17H25N7O3 — CID 19558477
3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]propan-1-one (PubChem CID 19558477) has the molecular formula C17H25N7O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 19558477 |
| Molecular Formula | C17H25N7O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]propan-1-one |
| SMILES | Cc1nn(CCC(=O)N2CCN(Cc3cnn(C)c3)CC2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N7O3/c1-13-17(24(26)27)14(2)23(19-13)5-4-16(25)22-8-6-21(7-9-22)12-15-10-18-20(3)11-15/h10-11H,4-9,12H2,1-3H3 |
| InChIKey | CJWZSYKGTWMFDD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 102.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|