C15H26ClN5O3 — CID 119546989
3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[4-(methylaminomethyl)piperidin-1-yl]propan-1-one;hydrochloride (PubChem CID 119546989) has the molecular formula C15H26ClN5O3 and a molecular weight of 359.86 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[4-(methylaminomethyl)piperidin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[4-(methylaminomethyl)piperidin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119546989 |
| Molecular Formula | C15H26ClN5O3 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[4-(methylaminomethyl)piperidin-1-yl]propan-1-one;hydrochloride |
| SMILES | CNCC1CCN(C(=O)CCn2nc(C)c([N+](=O)[O-])c2C)CC1.Cl |
| InChI | InChI=1S/C15H25N5O3.ClH/c1-11-15(20(22)23)12(2)19(17-11)9-6-14(21)18-7-4-13(5-8-18)10-16-3;/h13,16H,4-10H2,1-3H3;1H |
| InChIKey | NIYFQHGPUGIYAP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|