C23H32N4O5 — CID 86881692
1-[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-1-one (PubChem CID 86881692) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is 1-[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-1-one.
| Compound Name | 1-[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 86881692 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 1-[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-1-one |
| SMILES | COc1cc(CCC2CCN(C(=O)CCn3nc(C)c([N+](=O)[O-])c3C)CC2)cc(OC)c1 |
| InChI | InChI=1S/C23H32N4O5/c1-16-23(27(29)30)17(2)26(24-16)12-9-22(28)25-10-7-18(8-11-25)5-6-19-13-20(31-3)15-21(14-19)32-4/h13-15,18H,5-12H2,1-4H3 |
| InChIKey | FFLPXFVFSZLVGJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|