3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid

C8H11N3O4 — CID 4137846

IUPAC3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid
SMILESCc1nn(CCC(=O)O)c(C)c1[N+](=O)[O-]
InChIInChI=1S/C8H11N3O4/c1-5-8(11(14)15)6(2)10(9-5)4-3-7(12)13/h3-4H2,1-2H3,(H,12,13)
InChIKeyVGKCUVQITAZDAF-UHFFFAOYSA-N
MW213.19 g/mol
LogP0.88
Rot. Bonds4

About 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid

3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid (PubChem CID 4137846) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid.

Molecular Properties

Compound Name3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid
PubChem CID4137846
Molecular FormulaC8H11N3O4
Molecular Weight213.19 g/mol
Exact Mass213.07
IUPAC Name3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid
SMILESCc1nn(CCC(=O)O)c(C)c1[N+](=O)[O-]
InChIInChI=1S/C8H11N3O4/c1-5-8(11(14)15)6(2)10(9-5)4-3-7(12)13/h3-4H2,1-2H3,(H,12,13)
InChIKeyVGKCUVQITAZDAF-UHFFFAOYSA-N
XLogP0.88
TPSA98.26 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.19
LogP ≤ 50.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid?
The IUPAC name of 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid (CID 4137846) is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid.
What is the SMILES notation for 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid?
The canonical SMILES for 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid is Cc1nn(CCC(=O)O)c(C)c1[N+](=O)[O-].
What is the InChIKey of 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid?
The InChIKey is VGKCUVQITAZDAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O4/c1-5-8(11(14)15)6(2)10(9-5)4-3-7(12)13/h3-4H2,1-2H3,(H,12,13).
What are the key properties of 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid?
3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid has a molecular weight of 213.19 g/mol, XLogP of 0.88, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid is sourced from PubChem (CID 4137846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).