C10H17N5O3 — CID 63577216
5-(3,5-dimethyl-4-nitropyrazol-1-yl)pentanehydrazide (PubChem CID 63577216) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is 5-(3,5-dimethyl-4-nitropyrazol-1-yl)pentanehydrazide.
| Compound Name | 5-(3,5-dimethyl-4-nitropyrazol-1-yl)pentanehydrazide |
|---|---|
| PubChem CID | 63577216 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 5-(3,5-dimethyl-4-nitropyrazol-1-yl)pentanehydrazide |
| SMILES | Cc1nn(CCCCC(=O)NN)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H17N5O3/c1-7-10(15(17)18)8(2)14(13-7)6-4-3-5-9(16)12-11/h3-6,11H2,1-2H3,(H,12,16) |
| InChIKey | XEYUYCWCRZABBM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|