C13H16N6O3 — CID 154755562
3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylpyrimidin-2-yl)propanamide (PubChem CID 154755562) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylpyrimidin-2-yl)propanamide.
| Compound Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylpyrimidin-2-yl)propanamide |
|---|---|
| PubChem CID | 154755562 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(4-methylpyrimidin-2-yl)propanamide |
| SMILES | Cc1ccnc(NC(=O)CCn2nc(C)c([N+](=O)[O-])c2C)n1 |
| InChI | InChI=1S/C13H16N6O3/c1-8-4-6-14-13(15-8)16-11(20)5-7-18-10(3)12(19(21)22)9(2)17-18/h4,6H,5,7H2,1-3H3,(H,14,15,16,20) |
| InChIKey | NSJDMDJXLUJAFS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|