C18H21N7O3 — CID 19557874
3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[1-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]propanamide (PubChem CID 19557874) has the molecular formula C18H21N7O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[1-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]propanamide.
| Compound Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[1-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]propanamide |
|---|---|
| PubChem CID | 19557874 |
| Molecular Formula | C18H21N7O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[1-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]propanamide |
| SMILES | Cc1cccc(Cn2cnc(NC(=O)CCn3nc(C)c([N+](=O)[O-])c3C)n2)c1 |
| InChI | InChI=1S/C18H21N7O3/c1-12-5-4-6-15(9-12)10-23-11-19-18(22-23)20-16(26)7-8-24-14(3)17(25(27)28)13(2)21-24/h4-6,9,11H,7-8,10H2,1-3H3,(H,20,22,26) |
| InChIKey | LNBBLDMNVWFZCC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|