C18H20ClN7O3 — CID 19562285
N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanamide (PubChem CID 19562285) has the molecular formula C18H20ClN7O3 and a molecular weight of 417.86 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 19562285 |
| Molecular Formula | C18H20ClN7O3 |
| Molecular Weight | 417.86 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanamide |
| SMILES | Cc1nn(CC(C)C(=O)Nc2ncn(Cc3ccc(Cl)cc3)n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20ClN7O3/c1-11(8-25-13(3)16(26(28)29)12(2)22-25)17(27)21-18-20-10-24(23-18)9-14-4-6-15(19)7-5-14/h4-7,10-11H,8-9H2,1-3H3,(H,21,23,27) |
| InChIKey | JABUFFHQGAYKIR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|