C16H16ClN7O3 — CID 19538891
N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-3-nitropyrazol-1-yl)propanamide (PubChem CID 19538891) has the molecular formula C16H16ClN7O3 and a molecular weight of 389.80 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-3-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-3-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19538891 |
| Molecular Formula | C16H16ClN7O3 |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-3-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1C(C)C(=O)Nc1ncn(Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H16ClN7O3/c1-10-7-14(24(26)27)20-23(10)11(2)15(25)19-16-18-9-22(21-16)8-12-3-5-13(17)6-4-12/h3-7,9,11H,8H2,1-2H3,(H,19,21,25) |
| InChIKey | IAJKZATXWIHWCR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|