C7H11N5O3 — CID 17024630
2-(5-methyl-3-nitropyrazol-1-yl)propanehydrazide (PubChem CID 17024630) has the molecular formula C7H11N5O3 and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-(5-methyl-3-nitropyrazol-1-yl)propanehydrazide.
| Compound Name | 2-(5-methyl-3-nitropyrazol-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 17024630 |
| Molecular Formula | C7H11N5O3 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-(5-methyl-3-nitropyrazol-1-yl)propanehydrazide |
| SMILES | Cc1cc([N+](=O)[O-])nn1C(C)C(=O)NN |
| InChI | InChI=1S/C7H11N5O3/c1-4-3-6(12(14)15)10-11(4)5(2)7(13)9-8/h3,5H,8H2,1-2H3,(H,9,13) |
| InChIKey | ZHILFGNQBQWTNG-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|