C14H14N4O5 — CID 19585185
4-[2-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]benzoic acid (PubChem CID 19585185) has the molecular formula C14H14N4O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is 4-[2-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]benzoic acid.
| Compound Name | 4-[2-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 19585185 |
| Molecular Formula | C14H14N4O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-[2-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]benzoic acid |
| SMILES | Cc1cc([N+](=O)[O-])nn1C(C)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C14H14N4O5/c1-8-7-12(18(22)23)16-17(8)9(2)13(19)15-11-5-3-10(4-6-11)14(20)21/h3-7,9H,1-2H3,(H,15,19)(H,20,21) |
| InChIKey | JGKWVYOQVXBESL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|