C16H15Cl2N7O3 — CID 19539195
N-[1-[(3,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 19539195) has the molecular formula C16H15Cl2N7O3 and a molecular weight of 424.25 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19539195 |
| Molecular Formula | C16H15Cl2N7O3 |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1c([N+](=O)[O-])cnn1C(C)C(=O)Nc1ncn(Cc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H15Cl2N7O3/c1-9-14(25(27)28)6-20-24(9)10(2)15(26)21-16-19-8-23(22-16)7-11-3-4-12(17)13(18)5-11/h3-6,8,10H,7H2,1-2H3,(H,21,22,26) |
| InChIKey | MLVAMVDDHFLGAS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|