C17H15Cl3N6O3 — CID 19539237
N-[4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-2-(5-methyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 19539237) has the molecular formula C17H15Cl3N6O3 and a molecular weight of 457.71 g/mol. Its IUPAC name is N-[4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-2-(5-methyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-2-(5-methyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19539237 |
| Molecular Formula | C17H15Cl3N6O3 |
| Molecular Weight | 457.71 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | N-[4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-2-(5-methyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1c([N+](=O)[O-])cnn1C(C)C(=O)Nc1nn(Cc2c(Cl)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl3N6O3/c1-9-15(26(28)29)6-21-25(9)10(2)17(27)22-16-14(20)8-24(23-16)7-11-12(18)4-3-5-13(11)19/h3-6,8,10H,7H2,1-2H3,(H,22,23,27) |
| InChIKey | HYELFGWKMFORAE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.71 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|