C18H17Cl3N6O3 — CID 19528582
N-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 19528582) has the molecular formula C18H17Cl3N6O3 and a molecular weight of 471.73 g/mol. Its IUPAC name is N-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19528582 |
| Molecular Formula | C18H17Cl3N6O3 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | N-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1nn(C(C)C(=O)Nc2nn(Cc3ccc(Cl)cc3Cl)cc2Cl)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17Cl3N6O3/c1-9-16(27(29)30)10(2)26(23-9)11(3)18(28)22-17-15(21)8-25(24-17)7-12-4-5-13(19)6-14(12)20/h4-6,8,11H,7H2,1-3H3,(H,22,24,28) |
| InChIKey | INVCKLFYMHMVAP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|