C14H14ClFN4O3 — CID 1256201
(2R)-N-(3-chloro-4-fluorophenyl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 1256201) has the molecular formula C14H14ClFN4O3 and a molecular weight of 340.74 g/mol. Its IUPAC name is (2R)-N-(3-chloro-4-fluorophenyl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | (2R)-N-(3-chloro-4-fluorophenyl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 1256201 |
| Molecular Formula | C14H14ClFN4O3 |
| Molecular Weight | 340.74 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (2R)-N-(3-chloro-4-fluorophenyl)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1nn([C@H](C)C(=O)Nc2ccc(F)c(Cl)c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14ClFN4O3/c1-7-13(20(22)23)8(2)19(18-7)9(3)14(21)17-10-4-5-12(16)11(15)6-10/h4-6,9H,1-3H3,(H,17,21)/t9-/m1/s1 |
| InChIKey | FEARCJFGXBGSRT-SECBINFHSA-N |
| XLogP | 3.40 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|