C15H11Cl3N6O3 — CID 19263971
N-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-1-methyl-4-nitropyrazole-3-carboxamide (PubChem CID 19263971) has the molecular formula C15H11Cl3N6O3 and a molecular weight of 429.65 g/mol. Its IUPAC name is N-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-1-methyl-4-nitropyrazole-3-carboxamide.
| Compound Name | N-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-1-methyl-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19263971 |
| Molecular Formula | C15H11Cl3N6O3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | N-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-1-methyl-4-nitropyrazole-3-carboxamide |
| SMILES | Cn1cc([N+](=O)[O-])c(C(=O)Nc2nn(Cc3ccc(Cl)cc3Cl)cc2Cl)n1 |
| InChI | InChI=1S/C15H11Cl3N6O3/c1-22-7-12(24(26)27)13(20-22)15(25)19-14-11(18)6-23(21-14)5-8-2-3-9(16)4-10(8)17/h2-4,6-7H,5H2,1H3,(H,19,21,25) |
| InChIKey | OZPZRJIAMDNEKW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|