C16H13Cl3N6O3 — CID 19555640
N-[4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-3-(4-nitropyrazol-1-yl)propanamide (PubChem CID 19555640) has the molecular formula C16H13Cl3N6O3 and a molecular weight of 443.68 g/mol. Its IUPAC name is N-[4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-3-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-3-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19555640 |
| Molecular Formula | C16H13Cl3N6O3 |
| Molecular Weight | 443.68 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | N-[4-chloro-1-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]-3-(4-nitropyrazol-1-yl)propanamide |
| SMILES | O=C(CCn1cc([N+](=O)[O-])cn1)Nc1nn(Cc2c(Cl)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl3N6O3/c17-12-2-1-3-13(18)11(12)8-24-9-14(19)16(22-24)21-15(26)4-5-23-7-10(6-20-23)25(27)28/h1-3,6-7,9H,4-5,8H2,(H,21,22,26) |
| InChIKey | DKNYGQJLTNIYFY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.68 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|