C11H9Cl2N5O3 — CID 71869130
N-(4,5-dichloro-2-pyridinyl)-3-(4-nitropyrazol-1-yl)propanamide (PubChem CID 71869130) has the molecular formula C11H9Cl2N5O3 and a molecular weight of 330.13 g/mol. Its IUPAC name is N-(4,5-dichloro-2-pyridinyl)-3-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-(4,5-dichloro-2-pyridinyl)-3-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 71869130 |
| Molecular Formula | C11H9Cl2N5O3 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | N-(4,5-dichloro-2-pyridinyl)-3-(4-nitropyrazol-1-yl)propanamide |
| SMILES | O=C(CCn1cc([N+](=O)[O-])cn1)Nc1cc(Cl)c(Cl)cn1 |
| InChI | InChI=1S/C11H9Cl2N5O3/c12-8-3-10(14-5-9(8)13)16-11(19)1-2-17-6-7(4-15-17)18(20)21/h3-6H,1-2H2,(H,14,16,19) |
| InChIKey | UPUWSUHIIOOXCC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|