C15H13ClFN7O3 — CID 19555597
N-[1-[(2-chloro-4-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-3-(4-nitropyrazol-1-yl)propanamide (PubChem CID 19555597) has the molecular formula C15H13ClFN7O3 and a molecular weight of 393.77 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-3-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-3-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19555597 |
| Molecular Formula | C15H13ClFN7O3 |
| Molecular Weight | 393.77 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-3-(4-nitropyrazol-1-yl)propanamide |
| SMILES | O=C(CCn1cc([N+](=O)[O-])cn1)Nc1ncn(Cc2ccc(F)cc2Cl)n1 |
| InChI | InChI=1S/C15H13ClFN7O3/c16-13-5-11(17)2-1-10(13)7-23-9-18-15(21-23)20-14(25)3-4-22-8-12(6-19-22)24(26)27/h1-2,5-6,8-9H,3-4,7H2,(H,20,21,25) |
| InChIKey | YGKJCLZZHAPQAI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.77 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|