C14H12ClN7O3 — CID 19516060
N-[1-[(3-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(4-nitropyrazol-1-yl)acetamide (PubChem CID 19516060) has the molecular formula C14H12ClN7O3 and a molecular weight of 361.75 g/mol. Its IUPAC name is N-[1-[(3-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[1-[(3-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19516060 |
| Molecular Formula | C14H12ClN7O3 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | N-[1-[(3-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(4-nitropyrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)Nc1ncn(Cc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H12ClN7O3/c15-11-3-1-2-10(4-11)6-21-9-16-14(19-21)18-13(23)8-20-7-12(5-17-20)22(24)25/h1-5,7,9H,6,8H2,(H,18,19,23) |
| InChIKey | IPGRBWGLJUBUOV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|