C15H18ClN5O2 — CID 22195281
1-[(3-chlorophenyl)methyl]-4-[(4-nitropyrazol-1-yl)methyl]piperazine (PubChem CID 22195281) has the molecular formula C15H18ClN5O2 and a molecular weight of 335.80 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-[(4-nitropyrazol-1-yl)methyl]piperazine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-[(4-nitropyrazol-1-yl)methyl]piperazine |
|---|---|
| PubChem CID | 22195281 |
| Molecular Formula | C15H18ClN5O2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-[(4-nitropyrazol-1-yl)methyl]piperazine |
| SMILES | O=[N+]([O-])c1cnn(CN2CCN(Cc3cccc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C15H18ClN5O2/c16-14-3-1-2-13(8-14)10-18-4-6-19(7-5-18)12-20-11-15(9-17-20)21(22)23/h1-3,8-9,11H,4-7,10,12H2 |
| InChIKey | BEOBERDNLOHPJB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|