C14H12FN7O3 — CID 19521672
N-[1-[(3-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(3-nitropyrazol-1-yl)acetamide (PubChem CID 19521672) has the molecular formula C14H12FN7O3 and a molecular weight of 345.29 g/mol. Its IUPAC name is N-[1-[(3-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[1-[(3-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19521672 |
| Molecular Formula | C14H12FN7O3 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N-[1-[(3-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(3-nitropyrazol-1-yl)acetamide |
| SMILES | O=C(Cn1ccc([N+](=O)[O-])n1)Nc1ncn(Cc2cccc(F)c2)n1 |
| InChI | InChI=1S/C14H12FN7O3/c15-11-3-1-2-10(6-11)7-21-9-16-14(19-21)17-13(23)8-20-5-4-12(18-20)22(24)25/h1-6,9H,7-8H2,(H,17,19,23) |
| InChIKey | MAUHZGWQHVPVLZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|