C12H14FN5S — CID 17282112
1-ethyl-3-[1-[(3-fluorophenyl)methyl]-1,2,4-triazol-3-yl]thiourea (PubChem CID 17282112) has the molecular formula C12H14FN5S and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-ethyl-3-[1-[(3-fluorophenyl)methyl]-1,2,4-triazol-3-yl]thiourea.
| Compound Name | 1-ethyl-3-[1-[(3-fluorophenyl)methyl]-1,2,4-triazol-3-yl]thiourea |
|---|---|
| PubChem CID | 17282112 |
| Molecular Formula | C12H14FN5S |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-ethyl-3-[1-[(3-fluorophenyl)methyl]-1,2,4-triazol-3-yl]thiourea |
| SMILES | CCNC(=S)Nc1ncn(Cc2cccc(F)c2)n1 |
| InChI | InChI=1S/C12H14FN5S/c1-2-14-12(19)16-11-15-8-18(17-11)7-9-4-3-5-10(13)6-9/h3-6,8H,2,7H2,1H3,(H2,14,16,17,19) |
| InChIKey | UZZWDIPIFKIOLP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|