C14H17Cl2N5S — CID 4772594
1-butyl-3-[1-[(3,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]thiourea (PubChem CID 4772594) has the molecular formula C14H17Cl2N5S and a molecular weight of 358.30 g/mol. Its IUPAC name is 1-butyl-3-[1-[(3,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]thiourea.
| Compound Name | 1-butyl-3-[1-[(3,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]thiourea |
|---|---|
| PubChem CID | 4772594 |
| Molecular Formula | C14H17Cl2N5S |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 1-butyl-3-[1-[(3,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]thiourea |
| SMILES | CCCCNC(=S)Nc1ncn(Cc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H17Cl2N5S/c1-2-3-6-17-14(22)19-13-18-9-21(20-13)8-10-4-5-11(15)12(16)7-10/h4-5,7,9H,2-3,6,8H2,1H3,(H2,17,19,20,22) |
| InChIKey | QIUSEBIHYNGGRG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|