C15H18Cl2N4O — CID 19405812
1-butyl-3-[1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]urea (PubChem CID 19405812) has the molecular formula C15H18Cl2N4O and a molecular weight of 341.24 g/mol. Its IUPAC name is 1-butyl-3-[1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]urea.
| Compound Name | 1-butyl-3-[1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 19405812 |
| Molecular Formula | C15H18Cl2N4O |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1-butyl-3-[1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]urea |
| SMILES | CCCCNC(=O)Nc1ccn(Cc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C15H18Cl2N4O/c1-2-3-7-18-15(22)19-14-6-8-21(20-14)10-11-4-5-12(16)13(17)9-11/h4-6,8-9H,2-3,7,10H2,1H3,(H2,18,19,20,22) |
| InChIKey | WUSGOABJMLBSTD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|