C24H22Cl2N4O3 — CID 19398922
N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 19398922) has the molecular formula C24H22Cl2N4O3 and a molecular weight of 485.37 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 19398922 |
| Molecular Formula | C24H22Cl2N4O3 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)Nc1ccn(Cc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C24H22Cl2N4O3/c25-19-10-9-16(14-20(19)26)15-29-13-11-21(28-29)27-22(31)8-2-1-5-12-30-23(32)17-6-3-4-7-18(17)24(30)33/h3-4,6-7,9-11,13-14H,1-2,5,8,12,15H2,(H,27,28,31) |
| InChIKey | JWKKEJYCFTZCCV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|