About (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate
(3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 8840162) has the molecular formula C19H15Cl2NO4
and a molecular weight of 392.24 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate |
| PubChem CID | 8840162 |
| Molecular Formula | C19H15Cl2NO4 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H15Cl2NO4/c20-15-8-7-12(10-16(15)21)11-26-17(23)6-3-9-22-18(24)13-4-1-2-5-14(13)19(22)25/h1-2,4-5,7-8,10H,3,6,9,11H2 |
| InChIKey | LUNUBNMRHLZIBB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate?
The IUPAC name of (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate (CID 8840162) is (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate.
What is the SMILES notation for (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate?
The canonical SMILES for (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate is O=C(CCCN1C(=O)c2ccccc2C1=O)OCc1ccc(Cl)c(Cl)c1.
What is the InChIKey of (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate?
The InChIKey is LUNUBNMRHLZIBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl2NO4/c20-15-8-7-12(10-16(15)21)11-26-17(23)6-3-9-22-18(24)13-4-1-2-5-14(13)19(22)25/h1-2,4-5,7-8,10H,3,6,9,11H2.
What are the key properties of (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate?
(3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate has a molecular weight of 392.24 g/mol, XLogP of 4.11, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl)methyl 4-(1,3-dioxoisoindol-2-yl)butanoate is sourced from PubChem (CID 8840162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).