C22H18N2O6 — CID 46816811
(1,3-dioxoisoindol-2-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 46816811) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 46816811 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)OCN1C(=O)c3ccccc3C1=O)C2=O |
| InChI | InChI=1S/C22H18N2O6/c1-13-8-9-16-17(11-13)22(29)23(19(16)26)10-4-7-18(25)30-12-24-20(27)14-5-2-3-6-15(14)21(24)28/h2-3,5-6,8-9,11H,4,7,10,12H2,1H3 |
| InChIKey | JFOIBKYBCNEUIZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|