C21H21NO4 — CID 110495074
3-(1,3-dioxoisoindol-2-yl)propyl 3-(4-methylphenyl)propanoate (PubChem CID 110495074) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 3-(4-methylphenyl)propanoate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 110495074 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 3-(4-methylphenyl)propanoate |
| SMILES | Cc1ccc(CCC(=O)OCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H21NO4/c1-15-7-9-16(10-8-15)11-12-19(23)26-14-4-13-22-20(24)17-5-2-3-6-18(17)21(22)25/h2-3,5-10H,4,11-14H2,1H3 |
| InChIKey | VRVOTLVOCMPPEZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|