C14H15NO5 — CID 110495069
3-(1,3-dioxoisoindol-2-yl)propyl 2-methoxyacetate (PubChem CID 110495069) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 2-methoxyacetate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 2-methoxyacetate |
|---|---|
| PubChem CID | 110495069 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 2-methoxyacetate |
| SMILES | COCC(=O)OCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H15NO5/c1-19-9-12(16)20-8-4-7-15-13(17)10-5-2-3-6-11(10)14(15)18/h2-3,5-6H,4,7-9H2,1H3 |
| InChIKey | JJTRVPLQSBLRJY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|