C19H23NO4 — CID 110495090
3-(1,3-dioxoisoindol-2-yl)propyl 2-cyclohexylacetate (PubChem CID 110495090) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 2-cyclohexylacetate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 2-cyclohexylacetate |
|---|---|
| PubChem CID | 110495090 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 2-cyclohexylacetate |
| SMILES | O=C(CC1CCCCC1)OCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H23NO4/c21-17(13-14-7-2-1-3-8-14)24-12-6-11-20-18(22)15-9-4-5-10-16(15)19(20)23/h4-5,9-10,14H,1-3,6-8,11-13H2 |
| InChIKey | RNSHLTGJMIQSTQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|