About 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate
3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate (PubChem CID 86902646) has the molecular formula C17H22N4O2
and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate.
Molecular Properties
| Compound Name | 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate |
| PubChem CID | 86902646 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate |
| SMILES | O=C(CC1CCCC1)OCCCn1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H22N4O2/c22-16(13-14-7-4-5-8-14)23-12-6-11-21-19-17(18-20-21)15-9-2-1-3-10-15/h1-3,9-10,14H,4-8,11-13H2 |
| InChIKey | GFBYNWXWUATKGA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate?
The IUPAC name of 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate (CID 86902646) is 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate.
What is the SMILES notation for 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate?
The canonical SMILES for 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate is O=C(CC1CCCC1)OCCCn1nnc(-c2ccccc2)n1.
What is the InChIKey of 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate?
The InChIKey is GFBYNWXWUATKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2/c22-16(13-14-7-4-5-8-14)23-12-6-11-21-19-17(18-20-21)15-9-2-1-3-10-15/h1-3,9-10,14H,4-8,11-13H2.
What are the key properties of 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate?
3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate has a molecular weight of 314.39 g/mol, XLogP of 2.85, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-phenyltetrazol-2-yl)propyl 2-cyclopentylacetate is sourced from PubChem (CID 86902646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).