C19H23NO5 — CID 166190465
6-(1,3-dioxoisoindol-2-yl)hexyl (2S)-oxolane-2-carboxylate (PubChem CID 166190465) has the molecular formula C19H23NO5 and a molecular weight of 345.39 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)hexyl (2S)-oxolane-2-carboxylate.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)hexyl (2S)-oxolane-2-carboxylate |
|---|---|
| PubChem CID | 166190465 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)hexyl (2S)-oxolane-2-carboxylate |
| SMILES | O=C(OCCCCCCN1C(=O)c2ccccc2C1=O)[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H23NO5/c21-17-14-8-3-4-9-15(14)18(22)20(17)11-5-1-2-6-12-25-19(23)16-10-7-13-24-16/h3-4,8-9,16H,1-2,5-7,10-13H2/t16-/m0/s1 |
| InChIKey | NJVZFPBJTXVXRN-INIZCTEOSA-N |
| XLogP | 2.57 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|