C18H15NO5 — CID 31980780
3-(1,3-dioxoisoindol-2-yl)propyl 4-hydroxybenzoate (PubChem CID 31980780) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 4-hydroxybenzoate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 31980780 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 4-hydroxybenzoate |
| SMILES | O=C(OCCCN1C(=O)c2ccccc2C1=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H15NO5/c20-13-8-6-12(7-9-13)18(23)24-11-3-10-19-16(21)14-4-1-2-5-15(14)17(19)22/h1-2,4-9,20H,3,10-11H2 |
| InChIKey | JOSKFABUVPTTPY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|