C20H20N2O6S — CID 36707218
4-(1,3-dioxoisoindol-2-yl)butyl 4-(methylsulfamoyl)benzoate (PubChem CID 36707218) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 4-(methylsulfamoyl)benzoate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 4-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 36707218 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 4-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)OCCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H20N2O6S/c1-21-29(26,27)15-10-8-14(9-11-15)20(25)28-13-5-4-12-22-18(23)16-6-2-3-7-17(16)19(22)24/h2-3,6-11,21H,4-5,12-13H2,1H3 |
| InChIKey | ZMEFCKMNQOKHCX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|