C19H18N2O6S — CID 8568285
2-(1,3-dioxoisoindol-2-yl)ethyl 4-(ethylsulfamoyl)benzoate (PubChem CID 8568285) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 4-(ethylsulfamoyl)benzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8568285 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)OCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C19H18N2O6S/c1-2-20-28(25,26)14-9-7-13(8-10-14)19(24)27-12-11-21-17(22)15-5-3-4-6-16(15)18(21)23/h3-10,20H,2,11-12H2,1H3 |
| InChIKey | PGEWBUFGSAVFGI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|