C21H16N2O7S — CID 3970570
(1,3-dioxoisoindol-2-yl)methyl 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 3970570) has the molecular formula C21H16N2O7S and a molecular weight of 440.43 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3970570 |
| Molecular Formula | C21H16N2O7S |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C21H16N2O7S/c24-19-17-5-1-2-6-18(17)20(25)23(19)13-30-21(26)14-7-9-16(10-8-14)31(27,28)22-12-15-4-3-11-29-15/h1-11,22H,12-13H2 |
| InChIKey | JUDARMCUGUIMQV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|