C21H17F2N3O5S — CID 16625051
[1-(difluoromethyl)benzimidazol-2-yl]methyl 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 16625051) has the molecular formula C21H17F2N3O5S and a molecular weight of 461.45 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 16625051 |
| Molecular Formula | C21H17F2N3O5S |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(OCc1nc2ccccc2n1C(F)F)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C21H17F2N3O5S/c22-21(23)26-18-6-2-1-5-17(18)25-19(26)13-31-20(27)14-7-9-16(10-8-14)32(28,29)24-12-15-4-3-11-30-15/h1-11,21,24H,12-13H2 |
| InChIKey | BTGSAZAGNKYKFU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |