C23H19F2N3O4S — CID 16624937
[1-(difluoromethyl)benzimidazol-2-yl]methyl 4-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 16624937) has the molecular formula C23H19F2N3O4S and a molecular weight of 471.49 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 16624937 |
| Molecular Formula | C23H19F2N3O4S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCc2nc3ccccc3n2C(F)F)cc1 |
| InChI | InChI=1S/C23H19F2N3O4S/c1-27(17-7-3-2-4-8-17)33(30,31)18-13-11-16(12-14-18)22(29)32-15-21-26-19-9-5-6-10-20(19)28(21)23(24)25/h2-14,23H,15H2,1H3 |
| InChIKey | YUTKDLYARQGRSK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |