C14H12F2N4O2 — CID 16625572
[1-(difluoromethyl)benzimidazol-2-yl]methyl 1-methylpyrazole-4-carboxylate (PubChem CID 16625572) has the molecular formula C14H12F2N4O2 and a molecular weight of 306.27 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl 1-methylpyrazole-4-carboxylate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 16625572 |
| Molecular Formula | C14H12F2N4O2 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 1-methylpyrazole-4-carboxylate |
| SMILES | Cn1cc(C(=O)OCc2nc3ccccc3n2C(F)F)cn1 |
| InChI | InChI=1S/C14H12F2N4O2/c1-19-7-9(6-17-19)13(21)22-8-12-18-10-4-2-3-5-11(10)20(12)14(15)16/h2-7,14H,8H2,1H3 |
| InChIKey | IAIJZEKQVRQFGM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |