C17H13F2N3O4S — CID 16963011
[1-(difluoromethyl)benzimidazol-2-yl]methyl 4-methylsulfanyl-3-nitrobenzoate (PubChem CID 16963011) has the molecular formula C17H13F2N3O4S and a molecular weight of 393.37 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-methylsulfanyl-3-nitrobenzoate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-methylsulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 16963011 |
| Molecular Formula | C17H13F2N3O4S |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-methylsulfanyl-3-nitrobenzoate |
| SMILES | CSc1ccc(C(=O)OCc2nc3ccccc3n2C(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13F2N3O4S/c1-27-14-7-6-10(8-13(14)22(24)25)16(23)26-9-15-20-11-4-2-3-5-12(11)21(15)17(18)19/h2-8,17H,9H2,1H3 |
| InChIKey | PUKJNIPWILIJLH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|