C19H16F2N4O4 — CID 32753137
[1-(difluoromethyl)benzimidazol-2-yl]methyl 4-(cyclopropylamino)-3-nitrobenzoate (PubChem CID 32753137) has the molecular formula C19H16F2N4O4 and a molecular weight of 402.36 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-(cyclopropylamino)-3-nitrobenzoate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-(cyclopropylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 32753137 |
| Molecular Formula | C19H16F2N4O4 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-(cyclopropylamino)-3-nitrobenzoate |
| SMILES | O=C(OCc1nc2ccccc2n1C(F)F)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16F2N4O4/c20-19(21)24-15-4-2-1-3-13(15)23-17(24)10-29-18(26)11-5-8-14(22-12-6-7-12)16(9-11)25(27)28/h1-5,8-9,12,19,22H,6-7,10H2 |
| InChIKey | WDZITCILPXOJMQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|